C10H16N6O2S — CID 63859364
N-[2-methyl-1-(7H-purin-6-ylamino)propan-2-yl]methanesulfonamide (PubChem CID 63859364) has the molecular formula C10H16N6O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[2-methyl-1-(7H-purin-6-ylamino)propan-2-yl]methanesulfonamide.
| Compound Name | N-[2-methyl-1-(7H-purin-6-ylamino)propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 63859364 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-[2-methyl-1-(7H-purin-6-ylamino)propan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNc1ncnc2nc[nH]c12)NS(C)(=O)=O |
| InChI | InChI=1S/C10H16N6O2S/c1-10(2,16-19(3,17)18)4-11-8-7-9(13-5-12-7)15-6-14-8/h5-6,16H,4H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | OEOQNWZBFHJLHM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |