C12H24N6O2S — CID 80907618
N-[1-[(6-hydrazinyl-5-propylpyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 80907618) has the molecular formula C12H24N6O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[1-[(6-hydrazinyl-5-propylpyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(6-hydrazinyl-5-propylpyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 80907618 |
| Molecular Formula | C12H24N6O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[1-[(6-hydrazinyl-5-propylpyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CCCc1c(NN)ncnc1NCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C12H24N6O2S/c1-5-6-9-10(15-8-16-11(9)17-13)14-7-12(2,3)18-21(4,19)20/h8,18H,5-7,13H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | RDOZVYIISDRZTK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|