C12H13N5OS — CID 95775337
(2R)-1-(7H-purin-6-ylamino)-2-thiophen-3-ylpropan-2-ol (PubChem CID 95775337) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is (2R)-1-(7H-purin-6-ylamino)-2-thiophen-3-ylpropan-2-ol.
| Compound Name | (2R)-1-(7H-purin-6-ylamino)-2-thiophen-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 95775337 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (2R)-1-(7H-purin-6-ylamino)-2-thiophen-3-ylpropan-2-ol |
| SMILES | C[C@](O)(CNc1ncnc2nc[nH]c12)c1ccsc1 |
| InChI | InChI=1S/C12H13N5OS/c1-12(18,8-2-3-19-4-8)5-13-10-9-11(15-6-14-9)17-7-16-10/h2-4,6-7,18H,5H2,1H3,(H2,13,14,15,16,17)/t12-/m0/s1 |
| InChIKey | HIBKOMXJBRXUGF-LBPRGKRZSA-N |
| XLogP | 1.73 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |