C10H8BrN5S — CID 47282308
N-[(4-bromothiophen-2-yl)methyl]-7H-purin-6-amine (PubChem CID 47282308) has the molecular formula C10H8BrN5S and a molecular weight of 310.18 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 47282308 |
| Molecular Formula | C10H8BrN5S |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-7H-purin-6-amine |
| SMILES | Brc1csc(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C10H8BrN5S/c11-6-1-7(17-3-6)2-12-9-8-10(14-4-13-8)16-5-15-9/h1,3-5H,2H2,(H2,12,13,14,15,16) |
| InChIKey | LNFBMLWTRJGHRB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |