C13H10BrN5O2 — CID 47078601
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-7H-purin-6-amine (PubChem CID 47078601) has the molecular formula C13H10BrN5O2 and a molecular weight of 348.16 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 47078601 |
| Molecular Formula | C13H10BrN5O2 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-7H-purin-6-amine |
| SMILES | Brc1cc(CNc2ncnc3nc[nH]c23)cc2c1OCO2 |
| InChI | InChI=1S/C13H10BrN5O2/c14-8-1-7(2-9-11(8)21-6-20-9)3-15-12-10-13(17-4-16-10)19-5-18-12/h1-2,4-5H,3,6H2,(H2,15,16,17,18,19) |
| InChIKey | HHLCSTMVBKOYNO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |