C12H15BrIN3O2 — CID 110918803
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110918803) has the molecular formula C12H15BrIN3O2 and a molecular weight of 440.08 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110918803 |
| Molecular Formula | C12H15BrIN3O2 |
| Molecular Weight | 440.08 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Brc1cc(CNC2=NCCCN2)cc2c1OCO2.I |
| InChI | InChI=1S/C12H14BrN3O2.HI/c13-9-4-8(5-10-11(9)18-7-17-10)6-16-12-14-2-1-3-15-12;/h4-5H,1-3,6-7H2,(H2,14,15,16);1H |
| InChIKey | HVIUTFAUYTVASJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.08 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|