C11H14BrFIN3 — CID 119112950
N-[(2-bromo-4-fluorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 119112950) has the molecular formula C11H14BrFIN3 and a molecular weight of 414.06 g/mol. Its IUPAC name is N-[(2-bromo-4-fluorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(2-bromo-4-fluorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 119112950 |
| Molecular Formula | C11H14BrFIN3 |
| Molecular Weight | 414.06 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | N-[(2-bromo-4-fluorophenyl)methyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Fc1ccc(CNC2=NCCCN2)c(Br)c1.I |
| InChI | InChI=1S/C11H13BrFN3.HI/c12-10-6-9(13)3-2-8(10)7-16-11-14-4-1-5-15-11;/h2-3,6H,1,4-5,7H2,(H2,14,15,16);1H |
| InChIKey | CSIONDZLUSWCHP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.06 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|