C12H16BrFIN3 — CID 110918871
N-[2-(5-bromo-2-fluorophenyl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110918871) has the molecular formula C12H16BrFIN3 and a molecular weight of 428.09 g/mol. Its IUPAC name is N-[2-(5-bromo-2-fluorophenyl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[2-(5-bromo-2-fluorophenyl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110918871 |
| Molecular Formula | C12H16BrFIN3 |
| Molecular Weight | 428.09 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | N-[2-(5-bromo-2-fluorophenyl)ethyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Fc1ccc(Br)cc1CCNC1=NCCCN1.I |
| InChI | InChI=1S/C12H15BrFN3.HI/c13-10-2-3-11(14)9(8-10)4-7-17-12-15-5-1-6-16-12;/h2-3,8H,1,4-7H2,(H2,15,16,17);1H |
| InChIKey | NEKXZQUOSYMULE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|