C14H20BrNO2 — CID 55033069
N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]hexan-3-amine (PubChem CID 55033069) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]hexan-3-amine.
| Compound Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]hexan-3-amine |
|---|---|
| PubChem CID | 55033069 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-[(7-bromo-1,3-benzodioxol-5-yl)methyl]hexan-3-amine |
| SMILES | CCCC(CC)NCc1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H20BrNO2/c1-3-5-11(4-2)16-8-10-6-12(15)14-13(7-10)17-9-18-14/h6-7,11,16H,3-5,8-9H2,1-2H3 |
| InChIKey | SXZMYFCKFLHLHA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |