C12H12N6 — CID 60965843
N-[(6-methyl-3-pyridinyl)methyl]-7H-purin-6-amine (PubChem CID 60965843) has the molecular formula C12H12N6 and a molecular weight of 240.27 g/mol. Its IUPAC name is N-[(6-methyl-3-pyridinyl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(6-methyl-3-pyridinyl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 60965843 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-[(6-methyl-3-pyridinyl)methyl]-7H-purin-6-amine |
| SMILES | Cc1ccc(CNc2ncnc3nc[nH]c23)cn1 |
| InChI | InChI=1S/C12H12N6/c1-8-2-3-9(4-13-8)5-14-11-10-12(16-6-15-10)18-7-17-11/h2-4,6-7H,5H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | JQVPHQPFKHOIQF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |