C17H15N9 — CID 70256184
N-benzyl-7H-purin-6-amine;7H-purine (PubChem CID 70256184) has the molecular formula C17H15N9 and a molecular weight of 345.37 g/mol. Its IUPAC name is N-benzyl-7H-purin-6-amine;7H-purine.
| Compound Name | N-benzyl-7H-purin-6-amine;7H-purine |
|---|---|
| PubChem CID | 70256184 |
| Molecular Formula | C17H15N9 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-benzyl-7H-purin-6-amine;7H-purine |
| SMILES | c1ccc(CNc2ncnc3nc[nH]c23)cc1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C12H11N5.C5H4N4/c1-2-4-9(5-3-1)6-13-11-10-12(15-7-14-10)17-8-16-11;1-4-5(8-2-6-1)9-3-7-4/h1-5,7-8H,6H2,(H2,13,14,15,16,17);1-3H,(H,6,7,8,9) |
| InChIKey | BGIPRCWGOJBTRE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |