About phenylmethoxymethylbenzene;7H-purine
phenylmethoxymethylbenzene;7H-purine (PubChem CID 71212113) has the molecular formula C19H18N4O
and a molecular weight of 318.38 g/mol. Its IUPAC name is phenylmethoxymethylbenzene;7H-purine.
Molecular Properties
| Compound Name | phenylmethoxymethylbenzene;7H-purine |
| PubChem CID | 71212113 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | phenylmethoxymethylbenzene;7H-purine |
| SMILES | c1ccc(COCc2ccccc2)cc1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C14H14O.C5H4N4/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-4-5(8-2-6-1)9-3-7-4/h1-10H,11-12H2;1-3H,(H,6,7,8,9) |
| InChIKey | XIYQASSDCLSASL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenylmethoxymethylbenzene;7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethoxymethylbenzene;7H-purine?
The IUPAC name of phenylmethoxymethylbenzene;7H-purine (CID 71212113) is phenylmethoxymethylbenzene;7H-purine.
What is the SMILES notation for phenylmethoxymethylbenzene;7H-purine?
The canonical SMILES for phenylmethoxymethylbenzene;7H-purine is c1ccc(COCc2ccccc2)cc1.c1ncc2[nH]cnc2n1.
What is the InChIKey of phenylmethoxymethylbenzene;7H-purine?
The InChIKey is XIYQASSDCLSASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C5H4N4/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-4-5(8-2-6-1)9-3-7-4/h1-10H,11-12H2;1-3H,(H,6,7,8,9).
What are the key properties of phenylmethoxymethylbenzene;7H-purine?
phenylmethoxymethylbenzene;7H-purine has a molecular weight of 318.38 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethoxymethylbenzene;7H-purine is sourced from PubChem (CID 71212113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).