About 7H-purine;1H-pyridin-2-one
7H-purine;1H-pyridin-2-one (PubChem CID 158035118) has the molecular formula C10H9N5O
and a molecular weight of 215.22 g/mol. Its IUPAC name is 7H-purine;1H-pyridin-2-one.
Molecular Properties
| Compound Name | 7H-purine;1H-pyridin-2-one |
| PubChem CID | 158035118 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 7H-purine;1H-pyridin-2-one |
| SMILES | O=c1cccc[nH]1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.C5H5NO/c1-4-5(8-2-6-1)9-3-7-4;7-5-3-1-2-4-6-5/h1-3H,(H,6,7,8,9);1-4H,(H,6,7) |
| InChIKey | FHQOXEBKITUBHZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7H-purine;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine;1H-pyridin-2-one?
The IUPAC name of 7H-purine;1H-pyridin-2-one (CID 158035118) is 7H-purine;1H-pyridin-2-one.
What is the SMILES notation for 7H-purine;1H-pyridin-2-one?
The canonical SMILES for 7H-purine;1H-pyridin-2-one is O=c1cccc[nH]1.c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine;1H-pyridin-2-one?
The InChIKey is FHQOXEBKITUBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.C5H5NO/c1-4-5(8-2-6-1)9-3-7-4;7-5-3-1-2-4-6-5/h1-3H,(H,6,7,8,9);1-4H,(H,6,7).
What are the key properties of 7H-purine;1H-pyridin-2-one?
7H-purine;1H-pyridin-2-one has a molecular weight of 215.22 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine;1H-pyridin-2-one is sourced from PubChem (CID 158035118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).