About gold;7H-purine;pyrimidine
gold;7H-purine;pyrimidine (PubChem CID 160695672) has the molecular formula C9H8AuN6
and a molecular weight of 397.17 g/mol. Its IUPAC name is gold;7H-purine;pyrimidine.
Molecular Properties
| Compound Name | gold;7H-purine;pyrimidine |
| PubChem CID | 160695672 |
| Molecular Formula | C9H8AuN6 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | gold;7H-purine;pyrimidine |
| SMILES | [Au].c1cncnc1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.C4H4N2.Au/c1-4-5(8-2-6-1)9-3-7-4;1-2-5-4-6-3-1;/h1-3H,(H,6,7,8,9);1-4H; |
| InChIKey | RPYSEHNXQMQFHO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze gold;7H-purine;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;7H-purine;pyrimidine?
The IUPAC name of gold;7H-purine;pyrimidine (CID 160695672) is gold;7H-purine;pyrimidine.
What is the SMILES notation for gold;7H-purine;pyrimidine?
The canonical SMILES for gold;7H-purine;pyrimidine is [Au].c1cncnc1.c1ncc2[nH]cnc2n1.
What is the InChIKey of gold;7H-purine;pyrimidine?
The InChIKey is RPYSEHNXQMQFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.C4H4N2.Au/c1-4-5(8-2-6-1)9-3-7-4;1-2-5-4-6-3-1;/h1-3H,(H,6,7,8,9);1-4H;.
What are the key properties of gold;7H-purine;pyrimidine?
gold;7H-purine;pyrimidine has a molecular weight of 397.17 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for gold;7H-purine;pyrimidine is sourced from PubChem (CID 160695672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).