About piperazine;7H-purine;pyridazine
piperazine;7H-purine;pyridazine (PubChem CID 174875966) has the molecular formula C13H18N8
and a molecular weight of 286.34 g/mol. Its IUPAC name is piperazine;7H-purine;pyridazine.
Molecular Properties
| Compound Name | piperazine;7H-purine;pyridazine |
| PubChem CID | 174875966 |
| Molecular Formula | C13H18N8 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | piperazine;7H-purine;pyridazine |
| SMILES | C1CNCCN1.c1ccnnc1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.C4H10N2.C4H4N2/c1-4-5(8-2-6-1)9-3-7-4;1-2-6-4-3-5-1;1-2-4-6-5-3-1/h1-3H,(H,6,7,8,9);5-6H,1-4H2;1-4H |
| InChIKey | UUZRKQCBGCNUTO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze piperazine;7H-purine;pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;7H-purine;pyridazine?
The IUPAC name of piperazine;7H-purine;pyridazine (CID 174875966) is piperazine;7H-purine;pyridazine.
What is the SMILES notation for piperazine;7H-purine;pyridazine?
The canonical SMILES for piperazine;7H-purine;pyridazine is C1CNCCN1.c1ccnnc1.c1ncc2[nH]cnc2n1.
What is the InChIKey of piperazine;7H-purine;pyridazine?
The InChIKey is UUZRKQCBGCNUTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.C4H10N2.C4H4N2/c1-4-5(8-2-6-1)9-3-7-4;1-2-6-4-3-5-1;1-2-4-6-5-3-1/h1-3H,(H,6,7,8,9);5-6H,1-4H2;1-4H.
What are the key properties of piperazine;7H-purine;pyridazine?
piperazine;7H-purine;pyridazine has a molecular weight of 286.34 g/mol, XLogP of 0.01, 0 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;7H-purine;pyridazine is sourced from PubChem (CID 174875966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).