About 7H-purine;trihydrochloride
7H-purine;trihydrochloride (PubChem CID 141012213) has the molecular formula C5H7Cl3N4
and a molecular weight of 229.50 g/mol. Its IUPAC name is 7H-purine;trihydrochloride.
Molecular Properties
| Compound Name | 7H-purine;trihydrochloride |
| PubChem CID | 141012213 |
| Molecular Formula | C5H7Cl3N4 |
| Molecular Weight | 229.50 g/mol |
| Exact Mass | 227.97 |
| IUPAC Name | 7H-purine;trihydrochloride |
| SMILES | Cl.Cl.Cl.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.3ClH/c1-4-5(8-2-6-1)9-3-7-4;;;/h1-3H,(H,6,7,8,9);3*1H |
| InChIKey | UZNQRSTWYFVQHM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-purine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine;trihydrochloride?
The IUPAC name of 7H-purine;trihydrochloride (CID 141012213) is 7H-purine;trihydrochloride.
What is the SMILES notation for 7H-purine;trihydrochloride?
The canonical SMILES for 7H-purine;trihydrochloride is Cl.Cl.Cl.c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine;trihydrochloride?
The InChIKey is UZNQRSTWYFVQHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.3ClH/c1-4-5(8-2-6-1)9-3-7-4;;;/h1-3H,(H,6,7,8,9);3*1H.
What are the key properties of 7H-purine;trihydrochloride?
7H-purine;trihydrochloride has a molecular weight of 229.50 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine;trihydrochloride is sourced from PubChem (CID 141012213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).