About ethanol;7H-purine
ethanol;7H-purine (PubChem CID 134205486) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is ethanol;7H-purine.
Molecular Properties
| Compound Name | ethanol;7H-purine |
| PubChem CID | 134205486 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | ethanol;7H-purine |
| SMILES | CCO.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.C2H6O/c1-4-5(8-2-6-1)9-3-7-4;1-2-3/h1-3H,(H,6,7,8,9);3H,2H2,1H3 |
| InChIKey | VOJIQCAVDJAYHT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethanol;7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;7H-purine?
The IUPAC name of ethanol;7H-purine (CID 134205486) is ethanol;7H-purine.
What is the SMILES notation for ethanol;7H-purine?
The canonical SMILES for ethanol;7H-purine is CCO.c1ncc2[nH]cnc2n1.
What is the InChIKey of ethanol;7H-purine?
The InChIKey is VOJIQCAVDJAYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.C2H6O/c1-4-5(8-2-6-1)9-3-7-4;1-2-3/h1-3H,(H,6,7,8,9);3H,2H2,1H3.
What are the key properties of ethanol;7H-purine?
ethanol;7H-purine has a molecular weight of 166.18 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;7H-purine is sourced from PubChem (CID 134205486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).