About 7H-purine thiocyanate
7H-purine thiocyanate (PubChem CID 19026223) has the molecular formula C6H4N5S-
and a molecular weight of 178.20 g/mol. Its IUPAC name is 7H-purine thiocyanate.
Molecular Properties
| Compound Name | 7H-purine thiocyanate |
| PubChem CID | 19026223 |
| Molecular Formula | C6H4N5S- |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 7H-purine thiocyanate |
| SMILES | N#C[S-].c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.CHNS/c1-4-5(8-2-6-1)9-3-7-4;2-1-3/h1-3H,(H,6,7,8,9);3H/p-1 |
| InChIKey | JMYCGCACDAVKFE-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 7H-purine thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine thiocyanate?
The IUPAC name of 7H-purine thiocyanate (CID 19026223) is 7H-purine thiocyanate.
What is the SMILES notation for 7H-purine thiocyanate?
The canonical SMILES for 7H-purine thiocyanate is N#C[S-].c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine thiocyanate?
The InChIKey is JMYCGCACDAVKFE-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N4.CHNS/c1-4-5(8-2-6-1)9-3-7-4;2-1-3/h1-3H,(H,6,7,8,9);3H/p-1.
What are the key properties of 7H-purine thiocyanate?
7H-purine thiocyanate has a molecular weight of 178.20 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine thiocyanate is sourced from PubChem (CID 19026223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).