About adamantane;7H-purine
adamantane;7H-purine (PubChem CID 175120168) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is adamantane;7H-purine.
Molecular Properties
| Compound Name | adamantane;7H-purine |
| PubChem CID | 175120168 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | adamantane;7H-purine |
| SMILES | C1C2CC3CC1CC(C2)C3.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C10H16.C5H4N4/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-4-5(8-2-6-1)9-3-7-4/h7-10H,1-6H2;1-3H,(H,6,7,8,9) |
| InChIKey | RWOWFACRWLFBOB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze adamantane;7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;7H-purine?
The IUPAC name of adamantane;7H-purine (CID 175120168) is adamantane;7H-purine.
What is the SMILES notation for adamantane;7H-purine?
The canonical SMILES for adamantane;7H-purine is C1C2CC3CC1CC(C2)C3.c1ncc2[nH]cnc2n1.
What is the InChIKey of adamantane;7H-purine?
The InChIKey is RWOWFACRWLFBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C5H4N4/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-4-5(8-2-6-1)9-3-7-4/h7-10H,1-6H2;1-3H,(H,6,7,8,9).
What are the key properties of adamantane;7H-purine?
adamantane;7H-purine has a molecular weight of 256.35 g/mol, XLogP of 3.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;7H-purine is sourced from PubChem (CID 175120168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).