About 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane
7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane (PubChem CID 23072308) has the molecular formula C5H7N4O3PS
and a molecular weight of 234.18 g/mol. Its IUPAC name is 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane.
Molecular Properties
| Compound Name | 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane |
| PubChem CID | 23072308 |
| Molecular Formula | C5H7N4O3PS |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane |
| SMILES | OP(O)(O)=S.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.H3O3PS/c1-4-5(8-2-6-1)9-3-7-4;1-4(2,3)5/h1-3H,(H,6,7,8,9);(H3,1,2,3,5) |
| InChIKey | JBCNZZKORZNYML-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane?
The IUPAC name of 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane (CID 23072308) is 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane.
What is the SMILES notation for 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane?
The canonical SMILES for 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane is OP(O)(O)=S.c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane?
The InChIKey is JBCNZZKORZNYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.H3O3PS/c1-4-5(8-2-6-1)9-3-7-4;1-4(2,3)5/h1-3H,(H,6,7,8,9);(H3,1,2,3,5).
What are the key properties of 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane?
7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane has a molecular weight of 234.18 g/mol, XLogP of -0.46, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine;trihydroxy(sulfanylidene)-λ5-phosphane is sourced from PubChem (CID 23072308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).