C12H9N5S — CID 144552506
7H-purine;thieno[2,3-b]pyridine (PubChem CID 144552506) has the molecular formula C12H9N5S and a molecular weight of 255.31 g/mol. Its IUPAC name is 7H-purine;thieno[2,3-b]pyridine.
| Compound Name | 7H-purine;thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 144552506 |
| Molecular Formula | C12H9N5S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 7H-purine;thieno[2,3-b]pyridine |
| SMILES | c1cnc2sccc2c1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C7H5NS.C5H4N4/c1-2-6-3-5-9-7(6)8-4-1;1-4-5(8-2-6-1)9-3-7-4/h1-5H;1-3H,(H,6,7,8,9) |
| InChIKey | LIMJPXDSDPWABT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |