C13H11Br2N5O — CID 10223442
N-[(3,5-dibromo-4-methoxyphenyl)methyl]-7H-purin-6-amine (PubChem CID 10223442) has the molecular formula C13H11Br2N5O and a molecular weight of 413.07 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-methoxyphenyl)methyl]-7H-purin-6-amine.
| Compound Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 10223442 |
| Molecular Formula | C13H11Br2N5O |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | N-[(3,5-dibromo-4-methoxyphenyl)methyl]-7H-purin-6-amine |
| SMILES | COc1c(Br)cc(CNc2ncnc3nc[nH]c23)cc1Br |
| InChI | InChI=1S/C13H11Br2N5O/c1-21-11-8(14)2-7(3-9(11)15)4-16-12-10-13(18-5-17-10)20-6-19-12/h2-3,5-6H,4H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | OVLYKYQZUJVBNO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |