C10H15N5O2 — CID 139625079
N-(2,2-dimethoxypropyl)-7H-purin-6-amine (PubChem CID 139625079) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(2,2-dimethoxypropyl)-7H-purin-6-amine.
| Compound Name | N-(2,2-dimethoxypropyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 139625079 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(2,2-dimethoxypropyl)-7H-purin-6-amine |
| SMILES | COC(C)(CNc1ncnc2nc[nH]c12)OC |
| InChI | InChI=1S/C10H15N5O2/c1-10(16-2,17-3)4-11-8-7-9(13-5-12-7)15-6-14-8/h5-6H,4H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | FPQFRURUFJBEBY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|