C14H15N5O3 — CID 123171522
3,6-dimethoxy-2-[(7H-purin-6-ylamino)methyl]phenol (PubChem CID 123171522) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 3,6-dimethoxy-2-[(7H-purin-6-ylamino)methyl]phenol.
| Compound Name | 3,6-dimethoxy-2-[(7H-purin-6-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 123171522 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3,6-dimethoxy-2-[(7H-purin-6-ylamino)methyl]phenol |
| SMILES | COc1ccc(OC)c(CNc2ncnc3nc[nH]c23)c1O |
| InChI | InChI=1S/C14H15N5O3/c1-21-9-3-4-10(22-2)12(20)8(9)5-15-13-11-14(17-6-16-11)19-7-18-13/h3-4,6-7,20H,5H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | ITJSCCSRJGFJDO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|