C12H10IN5O — CID 69243142
3-iodo-2-[(7H-purin-6-ylamino)methyl]phenol (PubChem CID 69243142) has the molecular formula C12H10IN5O and a molecular weight of 367.15 g/mol. Its IUPAC name is 3-iodo-2-[(7H-purin-6-ylamino)methyl]phenol.
| Compound Name | 3-iodo-2-[(7H-purin-6-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 69243142 |
| Molecular Formula | C12H10IN5O |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3-iodo-2-[(7H-purin-6-ylamino)methyl]phenol |
| SMILES | Oc1cccc(I)c1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H10IN5O/c13-8-2-1-3-9(19)7(8)4-14-11-10-12(16-5-15-10)18-6-17-11/h1-3,5-6,19H,4H2,(H2,14,15,16,17,18) |
| InChIKey | QMXRUBPJZUPHNM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|