C12H13N7 — CID 104623346
6-N-[(6-methyl-3-pyridinyl)methyl]-7H-purine-2,6-diamine (PubChem CID 104623346) has the molecular formula C12H13N7 and a molecular weight of 255.29 g/mol. Its IUPAC name is 6-N-[(6-methyl-3-pyridinyl)methyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(6-methyl-3-pyridinyl)methyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 104623346 |
| Molecular Formula | C12H13N7 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 6-N-[(6-methyl-3-pyridinyl)methyl]-7H-purine-2,6-diamine |
| SMILES | Cc1ccc(CNc2nc(N)nc3nc[nH]c23)cn1 |
| InChI | InChI=1S/C12H13N7/c1-7-2-3-8(4-14-7)5-15-10-9-11(17-6-16-9)19-12(13)18-10/h2-4,6H,5H2,1H3,(H4,13,15,16,17,18,19) |
| InChIKey | VYWBWJJMGZRCCO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |