C10H11N7S — CID 114784347
6-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-7H-purine-2,6-diamine (PubChem CID 114784347) has the molecular formula C10H11N7S and a molecular weight of 261.31 g/mol. Its IUPAC name is 6-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114784347 |
| Molecular Formula | C10H11N7S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 6-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-7H-purine-2,6-diamine |
| SMILES | Cc1csc(CNc2nc(N)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C10H11N7S/c1-5-3-18-6(15-5)2-12-8-7-9(14-4-13-7)17-10(11)16-8/h3-4H,2H2,1H3,(H4,11,12,13,14,16,17) |
| InChIKey | HFTMNZQNEJXKJZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |