C13H12BrN5O — CID 47066472
N-[2-(3-bromophenoxy)ethyl]-7H-purin-6-amine (PubChem CID 47066472) has the molecular formula C13H12BrN5O and a molecular weight of 334.18 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-7H-purin-6-amine.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 47066472 |
| Molecular Formula | C13H12BrN5O |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-7H-purin-6-amine |
| SMILES | Brc1cccc(OCCNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C13H12BrN5O/c14-9-2-1-3-10(6-9)20-5-4-15-12-11-13(17-7-16-11)19-8-18-12/h1-3,6-8H,4-5H2,(H2,15,16,17,18,19) |
| InChIKey | UQGBUOSKLCJWLC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|