C10H18N4O4S — CID 136975775
N-[1-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 136975775) has the molecular formula C10H18N4O4S and a molecular weight of 290.35 g/mol. Its IUPAC name is N-[1-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 136975775 |
| Molecular Formula | C10H18N4O4S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-[1-[(5-methoxy-6-oxo-1H-pyrimidin-4-yl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | COc1c(NCC(C)(C)NS(C)(=O)=O)nc[nH]c1=O |
| InChI | InChI=1S/C10H18N4O4S/c1-10(2,14-19(4,16)17)5-11-8-7(18-3)9(15)13-6-12-8/h6,14H,5H2,1-4H3,(H2,11,12,13,15) |
| InChIKey | XYIDYHKCSFBLNI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |