C12H21N3O3 — CID 136864256
4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136864256) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136864256 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | CCC(CC)(CO)CNc1nc[nH]c(=O)c1OC |
| InChI | InChI=1S/C12H21N3O3/c1-4-12(5-2,7-16)6-13-10-9(18-3)11(17)15-8-14-10/h8,16H,4-7H2,1-3H3,(H2,13,14,15,17) |
| InChIKey | HNZMRMZSXVOMMA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |