C9H13N5O2S — CID 20832793
2-methyl-N-(7H-purin-6-yl)propane-1-sulfonamide (PubChem CID 20832793) has the molecular formula C9H13N5O2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-methyl-N-(7H-purin-6-yl)propane-1-sulfonamide.
| Compound Name | 2-methyl-N-(7H-purin-6-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 20832793 |
| Molecular Formula | C9H13N5O2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-methyl-N-(7H-purin-6-yl)propane-1-sulfonamide |
| SMILES | CC(C)CS(=O)(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H13N5O2S/c1-6(2)3-17(15,16)14-9-7-8(11-4-10-7)12-5-13-9/h4-6H,3H2,1-2H3,(H2,10,11,12,13,14) |
| InChIKey | MOEGIPLEHGYUTN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |