C13H21N5 — CID 129151813
N-(3-ethyl-2-methylpentan-3-yl)-7H-purin-6-amine (PubChem CID 129151813) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-(3-ethyl-2-methylpentan-3-yl)-7H-purin-6-amine.
| Compound Name | N-(3-ethyl-2-methylpentan-3-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 129151813 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-(3-ethyl-2-methylpentan-3-yl)-7H-purin-6-amine |
| SMILES | CCC(CC)(Nc1ncnc2nc[nH]c12)C(C)C |
| InChI | InChI=1S/C13H21N5/c1-5-13(6-2,9(3)4)18-12-10-11(15-7-14-10)16-8-17-12/h7-9H,5-6H2,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | MYNNAGBVJIOPNM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |