C14H23N5 — CID 123305094
N-(3,4-dimethylheptan-2-yl)-7H-purin-6-amine (PubChem CID 123305094) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3,4-dimethylheptan-2-yl)-7H-purin-6-amine.
| Compound Name | N-(3,4-dimethylheptan-2-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 123305094 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-(3,4-dimethylheptan-2-yl)-7H-purin-6-amine |
| SMILES | CCCC(C)C(C)C(C)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C14H23N5/c1-5-6-9(2)10(3)11(4)19-14-12-13(16-7-15-12)17-8-18-14/h7-11H,5-6H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | DEQLMAZVRNPZLF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |