C14H24N6 — CID 123369608
6-N-(3,4-dimethylheptan-2-yl)-7H-purine-2,6-diamine (PubChem CID 123369608) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 6-N-(3,4-dimethylheptan-2-yl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(3,4-dimethylheptan-2-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 123369608 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 6-N-(3,4-dimethylheptan-2-yl)-7H-purine-2,6-diamine |
| SMILES | CCCC(C)C(C)C(C)Nc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H24N6/c1-5-6-8(2)9(3)10(4)18-13-11-12(17-7-16-11)19-14(15)20-13/h7-10H,5-6H2,1-4H3,(H4,15,16,17,18,19,20) |
| InChIKey | LMEQTCIDYXGWOT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |