C14H23N5 — CID 131972661
N-(3-ethyl-2,4-dimethylpentan-3-yl)-7H-purin-6-amine (PubChem CID 131972661) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3-ethyl-2,4-dimethylpentan-3-yl)-7H-purin-6-amine.
| Compound Name | N-(3-ethyl-2,4-dimethylpentan-3-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 131972661 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-(3-ethyl-2,4-dimethylpentan-3-yl)-7H-purin-6-amine |
| SMILES | CCC(Nc1ncnc2nc[nH]c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H23N5/c1-6-14(9(2)3,10(4)5)19-13-11-12(16-7-15-11)17-8-18-13/h7-10H,6H2,1-5H3,(H2,15,16,17,18,19) |
| InChIKey | VAISUAQEKMKXGP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |