C11H16ClN5 — CID 106167718
N-(1-chloro-3-methylpentan-3-yl)-7H-purin-6-amine (PubChem CID 106167718) has the molecular formula C11H16ClN5 and a molecular weight of 253.74 g/mol. Its IUPAC name is N-(1-chloro-3-methylpentan-3-yl)-7H-purin-6-amine.
| Compound Name | N-(1-chloro-3-methylpentan-3-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 106167718 |
| Molecular Formula | C11H16ClN5 |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(1-chloro-3-methylpentan-3-yl)-7H-purin-6-amine |
| SMILES | CCC(C)(CCCl)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H16ClN5/c1-3-11(2,4-5-12)17-10-8-9(14-6-13-8)15-7-16-10/h6-7H,3-5H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | CCLLSKFUPXWXIX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|