C13H15N5O2 — CID 141179189
N-(furan-2-ylmethyl)-7H-purin-6-amine;propan-2-one (PubChem CID 141179189) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-7H-purin-6-amine;propan-2-one.
| Compound Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;propan-2-one |
|---|---|
| PubChem CID | 141179189 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;propan-2-one |
| SMILES | CC(C)=O.c1coc(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C10H9N5O.C3H6O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9;1-3(2)4/h1-3,5-6H,4H2,(H2,11,12,13,14,15);1-2H3 |
| InChIKey | TVZLUZPEUHVSCX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |