C12H12N6O2 — CID 118310080
N-[6-(furan-2-ylmethylamino)-7H-purin-2-yl]acetamide (PubChem CID 118310080) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is N-[6-(furan-2-ylmethylamino)-7H-purin-2-yl]acetamide.
| Compound Name | N-[6-(furan-2-ylmethylamino)-7H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 118310080 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-[6-(furan-2-ylmethylamino)-7H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(NCc2ccco2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H12N6O2/c1-7(19)16-12-17-10(9-11(18-12)15-6-14-9)13-5-8-3-2-4-20-8/h2-4,6H,5H2,1H3,(H3,13,14,15,16,17,18,19) |
| InChIKey | HSKCOMHJOLHDGU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |