C12H13N7 — CID 131856143
N-benzyl-2-hydrazinyl-7H-purin-6-amine (PubChem CID 131856143) has the molecular formula C12H13N7 and a molecular weight of 255.29 g/mol. Its IUPAC name is N-benzyl-2-hydrazinyl-7H-purin-6-amine.
| Compound Name | N-benzyl-2-hydrazinyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 131856143 |
| Molecular Formula | C12H13N7 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-benzyl-2-hydrazinyl-7H-purin-6-amine |
| SMILES | NNc1nc(NCc2ccccc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H13N7/c13-19-12-17-10(9-11(18-12)16-7-15-9)14-6-8-4-2-1-3-5-8/h1-5,7H,6,13H2,(H3,14,15,16,17,18,19) |
| InChIKey | CUICXQPEOMMVHH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|