C19H16N8 — CID 117092742
6-N-(1H-benzimidazol-2-ylmethyl)-2-N-phenyl-7H-purine-2,6-diamine (PubChem CID 117092742) has the molecular formula C19H16N8 and a molecular weight of 356.39 g/mol. Its IUPAC name is 6-N-(1H-benzimidazol-2-ylmethyl)-2-N-phenyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-(1H-benzimidazol-2-ylmethyl)-2-N-phenyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 117092742 |
| Molecular Formula | C19H16N8 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 6-N-(1H-benzimidazol-2-ylmethyl)-2-N-phenyl-7H-purine-2,6-diamine |
| SMILES | c1ccc(Nc2nc(NCc3nc4ccccc4[nH]3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C19H16N8/c1-2-6-12(7-3-1)23-19-26-17(16-18(27-19)22-11-21-16)20-10-15-24-13-8-4-5-9-14(13)25-15/h1-9,11H,10H2,(H,24,25)(H3,20,21,22,23,26,27) |
| InChIKey | HMHKSXYPPLNGQX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |