C15H18N6O — CID 167822982
2-N-(2-methoxypropyl)-6-N-phenyl-7H-purine-2,6-diamine (PubChem CID 167822982) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-N-(2-methoxypropyl)-6-N-phenyl-7H-purine-2,6-diamine.
| Compound Name | 2-N-(2-methoxypropyl)-6-N-phenyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 167822982 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-N-(2-methoxypropyl)-6-N-phenyl-7H-purine-2,6-diamine |
| SMILES | COC(C)CNc1nc(Nc2ccccc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C15H18N6O/c1-10(22-2)8-16-15-20-13-12(17-9-18-13)14(21-15)19-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H3,16,17,18,19,20,21) |
| InChIKey | LNRYVQDNZPFPJJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |