C17H14N6O — CID 117079759
2-(6-methoxy-3-pyridinyl)-N-phenyl-7H-purin-6-amine (PubChem CID 117079759) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-N-phenyl-7H-purin-6-amine.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-N-phenyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 117079759 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-N-phenyl-7H-purin-6-amine |
| SMILES | COc1ccc(-c2nc(Nc3ccccc3)c3[nH]cnc3n2)cn1 |
| InChI | InChI=1S/C17H14N6O/c1-24-13-8-7-11(9-18-13)15-22-16-14(19-10-20-16)17(23-15)21-12-5-3-2-4-6-12/h2-10H,1H3,(H2,19,20,21,22,23) |
| InChIKey | HWOABPJBODBVIF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |