C17H16N4O — CID 117090011
2-(6-methoxy-3-pyridinyl)-6-methyl-N-phenylpyrimidin-4-amine (PubChem CID 117090011) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-6-methyl-N-phenylpyrimidin-4-amine.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-6-methyl-N-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 117090011 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-6-methyl-N-phenylpyrimidin-4-amine |
| SMILES | COc1ccc(-c2nc(C)cc(Nc3ccccc3)n2)cn1 |
| InChI | InChI=1S/C17H16N4O/c1-12-10-15(20-14-6-4-3-5-7-14)21-17(19-12)13-8-9-16(22-2)18-11-13/h3-11H,1-2H3,(H,19,20,21) |
| InChIKey | NLXVDQHDKZFMFQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |