C21H22N4O4 — CID 3043892
4-[[6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 3043892) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[[6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]amino]benzamide.
| Compound Name | 4-[[6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 3043892 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-[[6-methyl-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | COc1cc(-c2nc(C)cc(Nc3ccc(C(N)=O)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N4O4/c1-12-9-18(24-15-7-5-13(6-8-15)20(22)26)25-21(23-12)14-10-16(27-2)19(29-4)17(11-14)28-3/h5-11H,1-4H3,(H2,22,26)(H,23,24,25) |
| InChIKey | JKCIEZBEMDSXRD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |