C26H29N5O7 — CID 3044721
N-hydroxy-2-[6-[4-(morpholine-4-carbonyl)anilino]-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide (PubChem CID 3044721) has the molecular formula C26H29N5O7 and a molecular weight of 523.55 g/mol. Its IUPAC name is N-hydroxy-2-[6-[4-(morpholine-4-carbonyl)anilino]-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide.
| Compound Name | N-hydroxy-2-[6-[4-(morpholine-4-carbonyl)anilino]-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 3044721 |
| Molecular Formula | C26H29N5O7 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-hydroxy-2-[6-[4-(morpholine-4-carbonyl)anilino]-2-(3,4,5-trimethoxyphenyl)pyrimidin-4-yl]acetamide |
| SMILES | COc1cc(-c2nc(CC(=O)NO)cc(Nc3ccc(C(=O)N4CCOCC4)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H29N5O7/c1-35-20-12-17(13-21(36-2)24(20)37-3)25-28-19(15-23(32)30-34)14-22(29-25)27-18-6-4-16(5-7-18)26(33)31-8-10-38-11-9-31/h4-7,12-14,34H,8-11,15H2,1-3H3,(H,30,32)(H,27,28,29) |
| InChIKey | RFTVJTVXZYPBSQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 144.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|