C19H23N3O5 — CID 109206544
morpholin-4-yl-[4-(3,4,5-trimethoxyanilino)-2-pyridinyl]methanone (PubChem CID 109206544) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is morpholin-4-yl-[4-(3,4,5-trimethoxyanilino)-2-pyridinyl]methanone.
| Compound Name | morpholin-4-yl-[4-(3,4,5-trimethoxyanilino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109206544 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | morpholin-4-yl-[4-(3,4,5-trimethoxyanilino)-2-pyridinyl]methanone |
| SMILES | COc1cc(Nc2ccnc(C(=O)N3CCOCC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23N3O5/c1-24-16-11-14(12-17(25-2)18(16)26-3)21-13-4-5-20-15(10-13)19(23)22-6-8-27-9-7-22/h4-5,10-12H,6-9H2,1-3H3,(H,20,21) |
| InChIKey | DUJXQFOAEIFRKU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |