C15H16N2O5 — CID 146673906
4-(3,4,5-trimethoxyanilino)pyridine-2-carboxylic acid (PubChem CID 146673906) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyanilino)pyridine-2-carboxylic acid.
| Compound Name | 4-(3,4,5-trimethoxyanilino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 146673906 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-(3,4,5-trimethoxyanilino)pyridine-2-carboxylic acid |
| SMILES | COc1cc(Nc2ccnc(C(=O)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C15H16N2O5/c1-20-12-7-10(8-13(21-2)14(12)22-3)17-9-4-5-16-11(6-9)15(18)19/h4-8H,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | CLHWSQCQENMRED-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |