C13H19N3O3 — CID 109205842
[4-(2-methoxyethylamino)-2-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 109205842) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is [4-(2-methoxyethylamino)-2-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(2-methoxyethylamino)-2-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 109205842 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [4-(2-methoxyethylamino)-2-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | COCCNc1ccnc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C13H19N3O3/c1-18-7-4-14-11-2-3-15-12(10-11)13(17)16-5-8-19-9-6-16/h2-3,10H,4-9H2,1H3,(H,14,15) |
| InChIKey | MQKIBRGMWZJBCH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|