C18H23N5O2 — CID 109205899
[4-(2-methoxyethylamino)-2-pyridinyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 109205899) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is [4-(2-methoxyethylamino)-2-pyridinyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [4-(2-methoxyethylamino)-2-pyridinyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109205899 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | [4-(2-methoxyethylamino)-2-pyridinyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | COCCNc1ccnc(C(=O)N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C18H23N5O2/c1-25-13-8-19-15-5-7-20-16(14-15)18(24)23-11-9-22(10-12-23)17-4-2-3-6-21-17/h2-7,14H,8-13H2,1H3,(H,19,20) |
| InChIKey | YORHHDVTWWECFY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|