C18H21N3O2 — CID 109205870
3,4-dihydro-1H-isoquinolin-2-yl-[4-(2-methoxyethylamino)-2-pyridinyl]methanone (PubChem CID 109205870) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[4-(2-methoxyethylamino)-2-pyridinyl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[4-(2-methoxyethylamino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109205870 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[4-(2-methoxyethylamino)-2-pyridinyl]methanone |
| SMILES | COCCNc1ccnc(C(=O)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-23-11-9-19-16-6-8-20-17(12-16)18(22)21-10-7-14-4-2-3-5-15(14)13-21/h2-6,8,12H,7,9-11,13H2,1H3,(H,19,20) |
| InChIKey | MUGQAOCVTJBTCA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|